| Name | METHYL 2-BROMO-4-NITROBENZOATE |
| Synonyms | 100959-22-6 methy 2-bromo-4-nitrobenzoate METHYL 2-BROMO-4-NITROBENZOATE Methyl 2-bromo-4-nitrobenzoate 2-Bromo-4-nitro-benzoic acid methyleste 3-Bromo-4-(methoxycarbonyl)nitrobenzene 2-BroMo-4-nitrobenzoic acid Methyl ester 4-nitro-2-broMobenzoic acid Methyl ester |
| CAS | 100959-22-6 |
| InChI | InChI=1/C8H6BrNO4/c1-14-8(11)6-3-2-5(10(12)13)4-7(6)9/h2-4H,1H3 |
| Molecular Formula | C8H6BrNO4 |
| Molar Mass | 260.04 |
| Density | 1.673±0.06 g/cm3(Predicted) |
| Melting Point | 82.0 to 86.0 °C |
| Boling Point | 339.2±27.0 °C(Predicted) |
| Flash Point | 158.942°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light orange to Yellow to Green |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.588 |